C28H26ClFN2O4 — CID 3681858
6-(2-chloro-6-fluorophenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 3681858) has the molecular formula C28H26ClFN2O4 and a molecular weight of 508.98 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 3681858 |
| Molecular Formula | C28H26ClFN2O4 |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1cc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2c(F)cccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C28H26ClFN2O4/c1-34-23-13-16(14-24(35-2)28(23)36-3)15-11-21-26(22(33)12-15)27(25-17(29)7-6-8-18(25)30)32-20-10-5-4-9-19(20)31-21/h4-10,13-15,27,31-32H,11-12H2,1-3H3 |
| InChIKey | NGYLIUDTLREWFV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |