C25H19Cl2FN2O — CID 40822578
(6R,9R)-9-(2-chloro-6-fluorophenyl)-6-(4-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 40822578) has the molecular formula C25H19Cl2FN2O and a molecular weight of 453.34 g/mol. Its IUPAC name is (6R,9R)-9-(2-chloro-6-fluorophenyl)-6-(4-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9R)-9-(2-chloro-6-fluorophenyl)-6-(4-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 40822578 |
| Molecular Formula | C25H19Cl2FN2O |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (6R,9R)-9-(2-chloro-6-fluorophenyl)-6-(4-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1C[C@H](c2c(F)cccc2Cl)CC2=C1[C@@H](c1ccc(Cl)cc1)Nc1ccccc1N2 |
| InChI | InChI=1S/C25H19Cl2FN2O/c26-16-10-8-14(9-11-16)25-24-21(29-19-6-1-2-7-20(19)30-25)12-15(13-22(24)31)23-17(27)4-3-5-18(23)28/h1-11,15,25,29-30H,12-13H2/t15-,25-/m1/s1 |
| InChIKey | REORVZHIQLLKGH-SGANQWHYSA-N |
| XLogP | 7.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |