C29H27ClN2O6 — CID 94485336
(6S,9S)-6-(6-chloro-1,3-benzodioxol-5-yl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 94485336) has the molecular formula C29H27ClN2O6 and a molecular weight of 535.00 g/mol. Its IUPAC name is (6S,9S)-6-(6-chloro-1,3-benzodioxol-5-yl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,9S)-6-(6-chloro-1,3-benzodioxol-5-yl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 94485336 |
| Molecular Formula | C29H27ClN2O6 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | (6S,9S)-6-(6-chloro-1,3-benzodioxol-5-yl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1cc([C@@H]2CC(=O)C3=C(C2)Nc2ccccc2N[C@@H]3c2cc3c(cc2Cl)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C29H27ClN2O6/c1-34-25-10-16(11-26(35-2)29(25)36-3)15-8-21-27(22(33)9-15)28(32-20-7-5-4-6-19(20)31-21)17-12-23-24(13-18(17)30)38-14-37-23/h4-7,10-13,15,28,31-32H,8-9,14H2,1-3H3/t15-,28+/m0/s1 |
| InChIKey | UPIZWWQFBASRMW-OHZJNBGDSA-N |
| XLogP | 6.07 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |