C30H38N4O4S — CID 3688058
4-[4-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-thiazol-2-yl]-N-(2-methyl-3-nitrophenyl)piperidine-1-carboxamide (PubChem CID 3688058) has the molecular formula C30H38N4O4S and a molecular weight of 550.73 g/mol. Its IUPAC name is 4-[4-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-thiazol-2-yl]-N-(2-methyl-3-nitrophenyl)piperidine-1-carboxamide.
| Compound Name | 4-[4-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-thiazol-2-yl]-N-(2-methyl-3-nitrophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 3688058 |
| Molecular Formula | C30H38N4O4S |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 4-[4-(3,5-ditert-butyl-4-hydroxyphenyl)-1,3-thiazol-2-yl]-N-(2-methyl-3-nitrophenyl)piperidine-1-carboxamide |
| SMILES | Cc1c(NC(=O)N2CCC(c3nc(-c4cc(C(C)(C)C)c(O)c(C(C)(C)C)c4)cs3)CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H38N4O4S/c1-18-23(9-8-10-25(18)34(37)38)32-28(36)33-13-11-19(12-14-33)27-31-24(17-39-27)20-15-21(29(2,3)4)26(35)22(16-20)30(5,6)7/h8-10,15-17,19,35H,11-14H2,1-7H3,(H,32,36) |
| InChIKey | DIHVAPRMSJIEMN-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|