C20H26N4O3S — CID 3865155
4-(4-tert-butyl-1,3-thiazol-2-yl)-N-(2-methyl-3-nitrophenyl)piperidine-1-carboxamide (PubChem CID 3865155) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 4-(4-tert-butyl-1,3-thiazol-2-yl)-N-(2-methyl-3-nitrophenyl)piperidine-1-carboxamide.
| Compound Name | 4-(4-tert-butyl-1,3-thiazol-2-yl)-N-(2-methyl-3-nitrophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 3865155 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-(4-tert-butyl-1,3-thiazol-2-yl)-N-(2-methyl-3-nitrophenyl)piperidine-1-carboxamide |
| SMILES | Cc1c(NC(=O)N2CCC(c3nc(C(C)(C)C)cs3)CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26N4O3S/c1-13-15(6-5-7-16(13)24(26)27)21-19(25)23-10-8-14(9-11-23)18-22-17(12-28-18)20(2,3)4/h5-7,12,14H,8-11H2,1-4H3,(H,21,25) |
| InChIKey | VXOUDPDIFXTTOD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|