C22H27N3OS — CID 3689571
3-(2-phenylethenylsulfanyl)-1-[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 3689571) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 3-(2-phenylethenylsulfanyl)-1-[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 3-(2-phenylethenylsulfanyl)-1-[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 3689571 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 3-(2-phenylethenylsulfanyl)-1-[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | O=C(CCSC=Cc1ccccc1)N1CCCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C22H27N3OS/c26-22(10-18-27-17-9-20-5-2-1-3-6-20)25-14-4-13-24(15-16-25)19-21-7-11-23-12-8-21/h1-3,5-9,11-12,17H,4,10,13-16,18-19H2 |
| InChIKey | QSMDJCABJNFWGI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|