C18H22FN5O4 — CID 3690299
tert-butyl 2-[[6-[(3-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]-methylamino]acetate (PubChem CID 3690299) has the molecular formula C18H22FN5O4 and a molecular weight of 391.40 g/mol. Its IUPAC name is tert-butyl 2-[[6-[(3-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]-methylamino]acetate.
| Compound Name | tert-butyl 2-[[6-[(3-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]-methylamino]acetate |
|---|---|
| PubChem CID | 3690299 |
| Molecular Formula | C18H22FN5O4 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | tert-butyl 2-[[6-[(3-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]-methylamino]acetate |
| SMILES | CN(CC(=O)OC(C)(C)C)c1ncnc(NCc2cccc(F)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22FN5O4/c1-18(2,3)28-14(25)10-23(4)17-15(24(26)27)16(21-11-22-17)20-9-12-6-5-7-13(19)8-12/h5-8,11H,9-10H2,1-4H3,(H,20,21,22) |
| InChIKey | ZSWRJWWRDYJSOB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|