C20H24N4O7 — CID 3809718
methyl 2-[4-[6-[methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-nitropyrimidin-4-yl]oxyphenyl]acetate (PubChem CID 3809718) has the molecular formula C20H24N4O7 and a molecular weight of 432.43 g/mol. Its IUPAC name is methyl 2-[4-[6-[methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-nitropyrimidin-4-yl]oxyphenyl]acetate.
| Compound Name | methyl 2-[4-[6-[methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-nitropyrimidin-4-yl]oxyphenyl]acetate |
|---|---|
| PubChem CID | 3809718 |
| Molecular Formula | C20H24N4O7 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | methyl 2-[4-[6-[methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-nitropyrimidin-4-yl]oxyphenyl]acetate |
| SMILES | COC(=O)Cc1ccc(Oc2ncnc(N(C)CC(=O)OC(C)(C)C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H24N4O7/c1-20(2,3)31-16(26)11-23(4)18-17(24(27)28)19(22-12-21-18)30-14-8-6-13(7-9-14)10-15(25)29-5/h6-9,12H,10-11H2,1-5H3 |
| InChIKey | OHLGBKOHKPBZJH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 133.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|