C17H17ClF2N4O5 — CID 3391044
tert-butyl 2-[[6-(2-chloro-3,5-difluorophenoxy)-5-nitropyrimidin-4-yl]-methylamino]acetate (PubChem CID 3391044) has the molecular formula C17H17ClF2N4O5 and a molecular weight of 430.80 g/mol. Its IUPAC name is tert-butyl 2-[[6-(2-chloro-3,5-difluorophenoxy)-5-nitropyrimidin-4-yl]-methylamino]acetate.
| Compound Name | tert-butyl 2-[[6-(2-chloro-3,5-difluorophenoxy)-5-nitropyrimidin-4-yl]-methylamino]acetate |
|---|---|
| PubChem CID | 3391044 |
| Molecular Formula | C17H17ClF2N4O5 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | tert-butyl 2-[[6-(2-chloro-3,5-difluorophenoxy)-5-nitropyrimidin-4-yl]-methylamino]acetate |
| SMILES | CN(CC(=O)OC(C)(C)C)c1ncnc(Oc2cc(F)cc(F)c2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17ClF2N4O5/c1-17(2,3)29-12(25)7-23(4)15-14(24(26)27)16(22-8-21-15)28-11-6-9(19)5-10(20)13(11)18/h5-6,8H,7H2,1-4H3 |
| InChIKey | QNJSTMUEOFHCDD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|