C27H22N4OS — CID 3692317
3-[(9-ethylcarbazol-3-yl)amino]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3692317) has the molecular formula C27H22N4OS and a molecular weight of 450.57 g/mol. Its IUPAC name is 3-[(9-ethylcarbazol-3-yl)amino]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[(9-ethylcarbazol-3-yl)amino]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3692317 |
| Molecular Formula | C27H22N4OS |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 3-[(9-ethylcarbazol-3-yl)amino]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | CCn1c2ccccc2c2cc(NC=C(C#N)c3nc(-c4ccc(OC)cc4)cs3)ccc21 |
| InChI | InChI=1S/C27H22N4OS/c1-3-31-25-7-5-4-6-22(25)23-14-20(10-13-26(23)31)29-16-19(15-28)27-30-24(17-33-27)18-8-11-21(32-2)12-9-18/h4-14,16-17,29H,3H2,1-2H3 |
| InChIKey | VOAFZGRZROHQAM-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|