C14H16N2O2S — CID 3692404
4-butanoyl-N-(thiophen-2-ylmethyl)-1H-pyrrole-2-carboxamide (PubChem CID 3692404) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-butanoyl-N-(thiophen-2-ylmethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-butanoyl-N-(thiophen-2-ylmethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 3692404 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-butanoyl-N-(thiophen-2-ylmethyl)-1H-pyrrole-2-carboxamide |
| SMILES | CCCC(=O)c1c[nH]c(C(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C14H16N2O2S/c1-2-4-13(17)10-7-12(15-8-10)14(18)16-9-11-5-3-6-19-11/h3,5-8,15H,2,4,9H2,1H3,(H,16,18) |
| InChIKey | GSNIAQOFLNKUBO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |