C17H24N2O3S — CID 3693234
ethyl 2-[(4-methylbenzoyl)carbamothioylamino]hexanoate (PubChem CID 3693234) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is ethyl 2-[(4-methylbenzoyl)carbamothioylamino]hexanoate.
| Compound Name | ethyl 2-[(4-methylbenzoyl)carbamothioylamino]hexanoate |
|---|---|
| PubChem CID | 3693234 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | ethyl 2-[(4-methylbenzoyl)carbamothioylamino]hexanoate |
| SMILES | CCCCC(NC(=S)NC(=O)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C17H24N2O3S/c1-4-6-7-14(16(21)22-5-2)18-17(23)19-15(20)13-10-8-12(3)9-11-13/h8-11,14H,4-7H2,1-3H3,(H2,18,19,20,23) |
| InChIKey | XHCIUAJMLSRQMN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|