C24H31N3O5 — CID 3694286
3-[2-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]-2-oxoethyl]-3H-2-benzofuran-1-one (PubChem CID 3694286) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-[2-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]-2-oxoethyl]-3H-2-benzofuran-1-one.
| Compound Name | 3-[2-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]-2-oxoethyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 3694286 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 3-[2-[4-[1-[2-(2-ethoxyethoxy)ethyl]imidazol-2-yl]piperidin-1-yl]-2-oxoethyl]-3H-2-benzofuran-1-one |
| SMILES | CCOCCOCCn1ccnc1C1CCN(C(=O)CC2OC(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C24H31N3O5/c1-2-30-15-16-31-14-13-27-12-9-25-23(27)18-7-10-26(11-8-18)22(28)17-21-19-5-3-4-6-20(19)24(29)32-21/h3-6,9,12,18,21H,2,7-8,10-11,13-17H2,1H3 |
| InChIKey | KQSGGOIIZVACRE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|