C25H21N3O5S — CID 571167
[3-(1,3-dioxoisoindol-2-yl)-2-(imidazole-1-carbothioyloxy)hex-5-enyl] benzoate (PubChem CID 571167) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2-(imidazole-1-carbothioyloxy)hex-5-enyl] benzoate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2-(imidazole-1-carbothioyloxy)hex-5-enyl] benzoate |
|---|---|
| PubChem CID | 571167 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2-(imidazole-1-carbothioyloxy)hex-5-enyl] benzoate |
| SMILES | C=CCC(C(COC(=O)c1ccccc1)OC(=S)n1ccnc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H21N3O5S/c1-2-8-20(28-22(29)18-11-6-7-12-19(18)23(28)30)21(33-25(34)27-14-13-26-16-27)15-32-24(31)17-9-4-3-5-10-17/h2-7,9-14,16,20-21H,1,8,15H2 |
| InChIKey | SSXUBDGECZPEAT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|