C18H14N2O2 — CID 134846922
(3S,4S)-4-imidazol-1-yl-3-phenyl-3,4-dihydroisochromen-1-one (PubChem CID 134846922) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is (3S,4S)-4-imidazol-1-yl-3-phenyl-3,4-dihydroisochromen-1-one.
| Compound Name | (3S,4S)-4-imidazol-1-yl-3-phenyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 134846922 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (3S,4S)-4-imidazol-1-yl-3-phenyl-3,4-dihydroisochromen-1-one |
| SMILES | O=C1O[C@@H](c2ccccc2)[C@@H](n2ccnc2)c2ccccc21 |
| InChI | InChI=1S/C18H14N2O2/c21-18-15-9-5-4-8-14(15)16(20-11-10-19-12-20)17(22-18)13-6-2-1-3-7-13/h1-12,16-17H/t16-,17-/m0/s1 |
| InChIKey | RKNVYNWJFIQLGP-IRXDYDNUSA-N |
| XLogP | 3.38 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |