C24H23N5O5 — CID 155637500
benzyl N-[4-[(1,3-dioxoisoindol-2-yl)-(imidazole-1-carbonyl)amino]butyl]carbamate (PubChem CID 155637500) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is benzyl N-[4-[(1,3-dioxoisoindol-2-yl)-(imidazole-1-carbonyl)amino]butyl]carbamate.
| Compound Name | benzyl N-[4-[(1,3-dioxoisoindol-2-yl)-(imidazole-1-carbonyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 155637500 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | benzyl N-[4-[(1,3-dioxoisoindol-2-yl)-(imidazole-1-carbonyl)amino]butyl]carbamate |
| SMILES | O=C(NCCCCN(C(=O)n1ccnc1)N1C(=O)c2ccccc2C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H23N5O5/c30-21-19-10-4-5-11-20(19)22(31)29(21)28(24(33)27-15-13-25-17-27)14-7-6-12-26-23(32)34-16-18-8-2-1-3-9-18/h1-5,8-11,13,15,17H,6-7,12,14,16H2,(H,26,32) |
| InChIKey | PGBAIVRTBJQBHF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|