C22H18ClF3N4O — CID 3694395
1-(4-chlorophenyl)-3-[4-[C-methyl-N-[4-(trifluoromethyl)anilino]carbonimidoyl]phenyl]urea (PubChem CID 3694395) has the molecular formula C22H18ClF3N4O and a molecular weight of 446.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[C-methyl-N-[4-(trifluoromethyl)anilino]carbonimidoyl]phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[C-methyl-N-[4-(trifluoromethyl)anilino]carbonimidoyl]phenyl]urea |
|---|---|
| PubChem CID | 3694395 |
| Molecular Formula | C22H18ClF3N4O |
| Molecular Weight | 446.86 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[C-methyl-N-[4-(trifluoromethyl)anilino]carbonimidoyl]phenyl]urea |
| SMILES | CC(=NNc1ccc(C(F)(F)F)cc1)c1ccc(NC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H18ClF3N4O/c1-14(29-30-20-10-4-16(5-11-20)22(24,25)26)15-2-8-18(9-3-15)27-21(31)28-19-12-6-17(23)7-13-19/h2-13,30H,1H3,(H2,27,28,31) |
| InChIKey | RXSWWHXWHRQCRM-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.86 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|