C18H13F2N3O3 — CID 3695666
3-benzyl-N-(2,4-difluorophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 3695666) has the molecular formula C18H13F2N3O3 and a molecular weight of 357.32 g/mol. Its IUPAC name is 3-benzyl-N-(2,4-difluorophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | 3-benzyl-N-(2,4-difluorophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 3695666 |
| Molecular Formula | C18H13F2N3O3 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3-benzyl-N-(2,4-difluorophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1cc(=O)n(Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H13F2N3O3/c19-12-6-7-14(13(20)8-12)21-17(25)15-9-16(24)23(18(26)22-15)10-11-4-2-1-3-5-11/h1-9H,10H2,(H,21,25)(H,22,26) |
| InChIKey | GQSKORIFPITCBN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |