C14H16NO+ — CID 3698591
2,4-dimethyl-1-phenylmethoxypyridin-1-ium (PubChem CID 3698591) has the molecular formula C14H16NO+ and a molecular weight of 214.29 g/mol. Its IUPAC name is 2,4-dimethyl-1-phenylmethoxypyridin-1-ium.
| Compound Name | 2,4-dimethyl-1-phenylmethoxypyridin-1-ium |
|---|---|
| PubChem CID | 3698591 |
| Molecular Formula | C14H16NO+ |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2,4-dimethyl-1-phenylmethoxypyridin-1-ium |
| SMILES | Cc1cc[n+](OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C14H16NO/c1-12-8-9-15(13(2)10-12)16-11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3/q+1 |
| InChIKey | BQFMJKCIMOKRMZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|