C26H34N2+2 — CID 69030208
1-[3-[3-[3-(2,4-dimethylpyridin-1-ium-1-yl)propyl]phenyl]propyl]-2,4-dimethylpyridin-1-ium (PubChem CID 69030208) has the molecular formula C26H34N2+2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-[3-[3-[3-(2,4-dimethylpyridin-1-ium-1-yl)propyl]phenyl]propyl]-2,4-dimethylpyridin-1-ium.
| Compound Name | 1-[3-[3-[3-(2,4-dimethylpyridin-1-ium-1-yl)propyl]phenyl]propyl]-2,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 69030208 |
| Molecular Formula | C26H34N2+2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 1-[3-[3-[3-(2,4-dimethylpyridin-1-ium-1-yl)propyl]phenyl]propyl]-2,4-dimethylpyridin-1-ium |
| SMILES | Cc1cc[n+](CCCc2cccc(CCC[n+]3ccc(C)cc3C)c2)c(C)c1 |
| InChI | InChI=1S/C26H34N2/c1-21-12-16-27(23(3)18-21)14-6-10-25-8-5-9-26(20-25)11-7-15-28-17-13-22(2)19-24(28)4/h5,8-9,12-13,16-20H,6-7,10-11,14-15H2,1-4H3/q+2 |
| InChIKey | UVGYZKFSKWQQGG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|