C10H15ClN2O6 — CID 44888930
2,4-dimethyl-1-(3-nitropropyl)pyridin-1-ium perchlorate (PubChem CID 44888930) has the molecular formula C10H15ClN2O6 and a molecular weight of 294.69 g/mol. Its IUPAC name is 2,4-dimethyl-1-(3-nitropropyl)pyridin-1-ium perchlorate.
| Compound Name | 2,4-dimethyl-1-(3-nitropropyl)pyridin-1-ium perchlorate |
|---|---|
| PubChem CID | 44888930 |
| Molecular Formula | C10H15ClN2O6 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2,4-dimethyl-1-(3-nitropropyl)pyridin-1-ium perchlorate |
| SMILES | Cc1cc[n+](CCC[N+](=O)[O-])c(C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C10H15N2O2.ClHO4/c1-9-4-7-11(10(2)8-9)5-3-6-12(13)14;2-1(3,4)5/h4,7-8H,3,5-6H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KNCOROCPJQZCCW-UHFFFAOYSA-M |
| XLogP | -3.50 |
| TPSA | 139.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|