C10H16NO+ — CID 68578625
3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol (PubChem CID 68578625) has the molecular formula C10H16NO+ and a molecular weight of 166.24 g/mol. Its IUPAC name is 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol.
| Compound Name | 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 68578625 |
| Molecular Formula | C10H16NO+ |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol |
| SMILES | Cc1cc[n+](CCCO)c(C)c1 |
| InChI | InChI=1S/C10H16NO/c1-9-4-6-11(5-3-7-12)10(2)8-9/h4,6,8,12H,3,5,7H2,1-2H3/q+1 |
| InChIKey | QGEAIOQAHRKHOQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|