About 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol
3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol (PubChem CID 68578625) has the molecular formula C10H16NO+
and a molecular weight of 166.24 g/mol. Its IUPAC name is 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol |
| PubChem CID | 68578625 |
| Molecular Formula | C10H16NO+ |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol |
| SMILES | Cc1cc[n+](CCCO)c(C)c1 |
| InChI | InChI=1S/C10H16NO/c1-9-4-6-11(5-3-7-12)10(2)8-9/h4,6,8,12H,3,5,7H2,1-2H3/q+1 |
| InChIKey | QGEAIOQAHRKHOQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol?
The IUPAC name of 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol (CID 68578625) is 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol.
What is the SMILES notation for 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol?
The canonical SMILES for 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol is Cc1cc[n+](CCCO)c(C)c1.
What is the InChIKey of 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol?
The InChIKey is QGEAIOQAHRKHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16NO/c1-9-4-6-11(5-3-7-12)10(2)8-9/h4,6,8,12H,3,5,7H2,1-2H3/q+1.
What are the key properties of 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol?
3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol has a molecular weight of 166.24 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylpyridin-1-ium-1-yl)propan-1-ol is sourced from PubChem (CID 68578625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).