C28H28BrN3O3 — CID 3698670
4-[(2-bromophenoxy)methyl]-N-[1-[4-(cyclopentanecarbonylamino)phenyl]ethylideneamino]benzamide (PubChem CID 3698670) has the molecular formula C28H28BrN3O3 and a molecular weight of 534.45 g/mol. Its IUPAC name is 4-[(2-bromophenoxy)methyl]-N-[1-[4-(cyclopentanecarbonylamino)phenyl]ethylideneamino]benzamide.
| Compound Name | 4-[(2-bromophenoxy)methyl]-N-[1-[4-(cyclopentanecarbonylamino)phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 3698670 |
| Molecular Formula | C28H28BrN3O3 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 4-[(2-bromophenoxy)methyl]-N-[1-[4-(cyclopentanecarbonylamino)phenyl]ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(COc2ccccc2Br)cc1)c1ccc(NC(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C28H28BrN3O3/c1-19(21-14-16-24(17-15-21)30-27(33)22-6-2-3-7-22)31-32-28(34)23-12-10-20(11-13-23)18-35-26-9-5-4-8-25(26)29/h4-5,8-17,22H,2-3,6-7,18H2,1H3,(H,30,33)(H,32,34) |
| InChIKey | ZTVCGMYGNNHFCC-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|