C17H22F3N3O3S — CID 3698809
[1-(benzotriazol-1-yl)-4,6,6-trimethylhept-1-en-2-yl] trifluoromethanesulfonate (PubChem CID 3698809) has the molecular formula C17H22F3N3O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is [1-(benzotriazol-1-yl)-4,6,6-trimethylhept-1-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [1-(benzotriazol-1-yl)-4,6,6-trimethylhept-1-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 3698809 |
| Molecular Formula | C17H22F3N3O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [1-(benzotriazol-1-yl)-4,6,6-trimethylhept-1-en-2-yl] trifluoromethanesulfonate |
| SMILES | CC(CC(=Cn1nnc2ccccc21)OS(=O)(=O)C(F)(F)F)CC(C)(C)C |
| InChI | InChI=1S/C17H22F3N3O3S/c1-12(10-16(2,3)4)9-13(26-27(24,25)17(18,19)20)11-23-15-8-6-5-7-14(15)21-22-23/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | FCCFEGXYAFMRMO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|