C17H17F3N4O3S — CID 3634227
1-(benzotriazol-1-yl)-1-[1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]pentan-2-one (PubChem CID 3634227) has the molecular formula C17H17F3N4O3S and a molecular weight of 414.41 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl)-1-[1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]pentan-2-one.
| Compound Name | 1-(benzotriazol-1-yl)-1-[1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]pentan-2-one |
|---|---|
| PubChem CID | 3634227 |
| Molecular Formula | C17H17F3N4O3S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 1-(benzotriazol-1-yl)-1-[1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]pentan-2-one |
| SMILES | CCCC(=O)C(C1C=CN(S(=O)(=O)C(F)(F)F)C=C1)n1nnc2ccccc21 |
| InChI | InChI=1S/C17H17F3N4O3S/c1-2-5-15(25)16(24-14-7-4-3-6-13(14)21-22-24)12-8-10-23(11-9-12)28(26,27)17(18,19)20/h3-4,6-12,16H,2,5H2,1H3 |
| InChIKey | NGHDRBQUUAPUBB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |