C16H20F3N3O3S — CID 6105556
[(E)-1-(benzotriazol-1-yl)non-1-en-2-yl] trifluoromethanesulfonate (PubChem CID 6105556) has the molecular formula C16H20F3N3O3S and a molecular weight of 391.42 g/mol. Its IUPAC name is [(E)-1-(benzotriazol-1-yl)non-1-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [(E)-1-(benzotriazol-1-yl)non-1-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 6105556 |
| Molecular Formula | C16H20F3N3O3S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [(E)-1-(benzotriazol-1-yl)non-1-en-2-yl] trifluoromethanesulfonate |
| SMILES | CCCCCCC/C(=C\n1nnc2ccccc21)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H20F3N3O3S/c1-2-3-4-5-6-9-13(25-26(23,24)16(17,18)19)12-22-15-11-8-7-10-14(15)20-21-22/h7-8,10-12H,2-6,9H2,1H3/b13-12+ |
| InChIKey | DUCRYSWQQSPNHZ-OUKQBFOZSA-N |
| XLogP | 4.46 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|