C15H24O2 — CID 3700025
8-tert-butyl-2-ethoxy-3,4,4a,8a-tetrahydro-2H-chromene (PubChem CID 3700025) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 8-tert-butyl-2-ethoxy-3,4,4a,8a-tetrahydro-2H-chromene.
| Compound Name | 8-tert-butyl-2-ethoxy-3,4,4a,8a-tetrahydro-2H-chromene |
|---|---|
| PubChem CID | 3700025 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 8-tert-butyl-2-ethoxy-3,4,4a,8a-tetrahydro-2H-chromene |
| SMILES | CCOC1CCC2C=CC=C(C(C)(C)C)C2O1 |
| InChI | InChI=1S/C15H24O2/c1-5-16-13-10-9-11-7-6-8-12(14(11)17-13)15(2,3)4/h6-8,11,13-14H,5,9-10H2,1-4H3 |
| InChIKey | TXBIPZZBQVVPDF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |