C18H28O2 — CID 155348368
5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene (PubChem CID 155348368) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene.
| Compound Name | 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 155348368 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene |
| SMILES | C=CC1=CCC(OC(C)OCCC2CCCCC2)C=C1 |
| InChI | InChI=1S/C18H28O2/c1-3-16-9-11-18(12-10-16)20-15(2)19-14-13-17-7-5-4-6-8-17/h3,9-11,15,17-18H,1,4-8,12-14H2,2H3 |
| InChIKey | JKMQIMQKZRGCNR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|