About 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene
5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene (PubChem CID 155348368) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene |
| PubChem CID | 155348368 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene |
| SMILES | C=CC1=CCC(OC(C)OCCC2CCCCC2)C=C1 |
| InChI | InChI=1S/C18H28O2/c1-3-16-9-11-18(12-10-16)20-15(2)19-14-13-17-7-5-4-6-8-17/h3,9-11,15,17-18H,1,4-8,12-14H2,2H3 |
| InChIKey | JKMQIMQKZRGCNR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene?
The IUPAC name of 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene (CID 155348368) is 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene.
What is the SMILES notation for 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene?
The canonical SMILES for 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene is C=CC1=CCC(OC(C)OCCC2CCCCC2)C=C1.
What is the InChIKey of 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene?
The InChIKey is JKMQIMQKZRGCNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-3-16-9-11-18(12-10-16)20-15(2)19-14-13-17-7-5-4-6-8-17/h3,9-11,15,17-18H,1,4-8,12-14H2,2H3.
What are the key properties of 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene?
5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene has a molecular weight of 276.42 g/mol, XLogP of 4.78, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2-cyclohexylethoxy)ethoxy]-2-ethenylcyclohexa-1,3-diene is sourced from PubChem (CID 155348368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).