C21H20N2O4 — CID 3701020
2-[4-(2-oxo-3H-indol-1-yl)piperidine-1-carbonyl]benzoic acid (PubChem CID 3701020) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-[4-(2-oxo-3H-indol-1-yl)piperidine-1-carbonyl]benzoic acid.
| Compound Name | 2-[4-(2-oxo-3H-indol-1-yl)piperidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 3701020 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[4-(2-oxo-3H-indol-1-yl)piperidine-1-carbonyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)N1CCC(N2C(=O)Cc3ccccc32)CC1 |
| InChI | InChI=1S/C21H20N2O4/c24-19-13-14-5-1-4-8-18(14)23(19)15-9-11-22(12-10-15)20(25)16-6-2-3-7-17(16)21(26)27/h1-8,15H,9-13H2,(H,26,27) |
| InChIKey | GARBKRIJTSWMIF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |