C17H16BrFNO4S- — CID 3701532
4-[(4-bromophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]butanoate (PubChem CID 3701532) has the molecular formula C17H16BrFNO4S- and a molecular weight of 429.29 g/mol. Its IUPAC name is 4-[(4-bromophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]butanoate.
| Compound Name | 4-[(4-bromophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]butanoate |
|---|---|
| PubChem CID | 3701532 |
| Molecular Formula | C17H16BrFNO4S- |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 4-[(4-bromophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]butanoate |
| SMILES | O=C([O-])CCCN(Cc1ccccc1F)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrFNO4S/c18-14-7-9-15(10-8-14)25(23,24)20(11-3-6-17(21)22)12-13-4-1-2-5-16(13)19/h1-2,4-5,7-10H,3,6,11-12H2,(H,21,22)/p-1 |
| InChIKey | HNURRXNIGUYJTK-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |