C12H16N6O4 — CID 3701878
N-[2-[(4-amino-1,2,5-oxadiazol-3-yl)oxy]ethyl]-N'-(4-nitrophenyl)ethane-1,2-diamine (PubChem CID 3701878) has the molecular formula C12H16N6O4 and a molecular weight of 308.30 g/mol. Its IUPAC name is N-[2-[(4-amino-1,2,5-oxadiazol-3-yl)oxy]ethyl]-N'-(4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-[2-[(4-amino-1,2,5-oxadiazol-3-yl)oxy]ethyl]-N'-(4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 3701878 |
| Molecular Formula | C12H16N6O4 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[2-[(4-amino-1,2,5-oxadiazol-3-yl)oxy]ethyl]-N'-(4-nitrophenyl)ethane-1,2-diamine |
| SMILES | Nc1nonc1OCCNCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H16N6O4/c13-11-12(17-22-16-11)21-8-7-14-5-6-15-9-1-3-10(4-2-9)18(19)20/h1-4,14-15H,5-8H2,(H2,13,16) |
| InChIKey | MWNLQFLEJCYDFU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|