C19H25BrN3S+ — CID 3702221
3-[2-(4-bromophenyl)-4-sulfanylidene-5,6,7,8-tetrahydroquinazolin-1-yl]propyl-dimethylazanium (PubChem CID 3702221) has the molecular formula C19H25BrN3S+ and a molecular weight of 407.40 g/mol. Its IUPAC name is 3-[2-(4-bromophenyl)-4-sulfanylidene-5,6,7,8-tetrahydroquinazolin-1-yl]propyl-dimethylazanium.
| Compound Name | 3-[2-(4-bromophenyl)-4-sulfanylidene-5,6,7,8-tetrahydroquinazolin-1-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 3702221 |
| Molecular Formula | C19H25BrN3S+ |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 3-[2-(4-bromophenyl)-4-sulfanylidene-5,6,7,8-tetrahydroquinazolin-1-yl]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCn1c(-c2ccc(Br)cc2)nc(=S)c2c1CCCC2 |
| InChI | InChI=1S/C19H24BrN3S/c1-22(2)12-5-13-23-17-7-4-3-6-16(17)19(24)21-18(23)14-8-10-15(20)11-9-14/h8-11H,3-7,12-13H2,1-2H3/p+1 |
| InChIKey | GBLABQBSNRGZJC-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 22.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|