C21H20N2S — CID 4569077
1-(4-methylphenyl)-2-phenyl-5,6,7,8-tetrahydroquinazoline-4-thione (PubChem CID 4569077) has the molecular formula C21H20N2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-phenyl-5,6,7,8-tetrahydroquinazoline-4-thione.
| Compound Name | 1-(4-methylphenyl)-2-phenyl-5,6,7,8-tetrahydroquinazoline-4-thione |
|---|---|
| PubChem CID | 4569077 |
| Molecular Formula | C21H20N2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(4-methylphenyl)-2-phenyl-5,6,7,8-tetrahydroquinazoline-4-thione |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)nc(=S)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C21H20N2S/c1-15-11-13-17(14-12-15)23-19-10-6-5-9-18(19)21(24)22-20(23)16-7-3-2-4-8-16/h2-4,7-8,11-14H,5-6,9-10H2,1H3 |
| InChIKey | GEMREHKNLAJARN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|