C23H22N2O2S — CID 40618152
1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-phenyl-5,6,7,8-tetrahydroquinazoline-4-thione (PubChem CID 40618152) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-phenyl-5,6,7,8-tetrahydroquinazoline-4-thione.
| Compound Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-phenyl-5,6,7,8-tetrahydroquinazoline-4-thione |
|---|---|
| PubChem CID | 40618152 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-phenyl-5,6,7,8-tetrahydroquinazoline-4-thione |
| SMILES | S=c1nc(-c2ccccc2)n(C[C@@H]2COc3ccccc3O2)c2c1CCCC2 |
| InChI | InChI=1S/C23H22N2O2S/c28-23-18-10-4-5-11-19(18)25(22(24-23)16-8-2-1-3-9-16)14-17-15-26-20-12-6-7-13-21(20)27-17/h1-3,6-9,12-13,17H,4-5,10-11,14-15H2/t17-/m1/s1 |
| InChIKey | NQQVYPMBZHYUKJ-QGZVFWFLSA-N |
| XLogP | 5.00 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|