C19H17N3S — CID 940591
2-phenyl-1-(pyridin-2-ylmethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-thione (PubChem CID 940591) has the molecular formula C19H17N3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-phenyl-1-(pyridin-2-ylmethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-thione.
| Compound Name | 2-phenyl-1-(pyridin-2-ylmethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 940591 |
| Molecular Formula | C19H17N3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-phenyl-1-(pyridin-2-ylmethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-4-thione |
| SMILES | S=c1nc(-c2ccccc2)n(Cc2ccccn2)c2c1CCC2 |
| InChI | InChI=1S/C19H17N3S/c23-19-16-10-6-11-17(16)22(13-15-9-4-5-12-20-15)18(21-19)14-7-2-1-3-8-14/h1-5,7-9,12H,6,10-11,13H2 |
| InChIKey | ZJWCIGHCYOJCOR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|