C24H20N6O3S — CID 37039186
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide (PubChem CID 37039186) has the molecular formula C24H20N6O3S and a molecular weight of 472.53 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide |
|---|---|
| PubChem CID | 37039186 |
| Molecular Formula | C24H20N6O3S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)Nc3ccc(-c4cn5ccsc5n4)cc3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H20N6O3S/c1-15-22(30(32)33)16(2)29(27-15)13-17-3-5-19(6-4-17)23(31)25-20-9-7-18(8-10-20)21-14-28-11-12-34-24(28)26-21/h3-12,14H,13H2,1-2H3,(H,25,31) |
| InChIKey | QOXJPGIHECDGPH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|