C20H22F3NO4 — CID 37039708
4-(2-ethoxyphenoxy)-N-[[4-(trifluoromethoxy)phenyl]methyl]butanamide (PubChem CID 37039708) has the molecular formula C20H22F3NO4 and a molecular weight of 397.39 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-[[4-(trifluoromethoxy)phenyl]methyl]butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-[[4-(trifluoromethoxy)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 37039708 |
| Molecular Formula | C20H22F3NO4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-[[4-(trifluoromethoxy)phenyl]methyl]butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3NO4/c1-2-26-17-6-3-4-7-18(17)27-13-5-8-19(25)24-14-15-9-11-16(12-10-15)28-20(21,22)23/h3-4,6-7,9-12H,2,5,8,13-14H2,1H3,(H,24,25) |
| InChIKey | QCXFOIFGEHSYPK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|