C7H8N4S — CID 3704317
2-prop-2-ynylsulfanylpyrimidine-4,6-diamine (PubChem CID 3704317) has the molecular formula C7H8N4S and a molecular weight of 180.24 g/mol. Its IUPAC name is 2-prop-2-ynylsulfanylpyrimidine-4,6-diamine.
| Compound Name | 2-prop-2-ynylsulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 3704317 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-prop-2-ynylsulfanylpyrimidine-4,6-diamine |
| SMILES | C#CCSc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C7H8N4S/c1-2-3-12-7-10-5(8)4-6(9)11-7/h1,4H,3H2,(H4,8,9,10,11) |
| InChIKey | ZVUGTZLXFHYDDT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|