C11H8F3N3O — CID 3705508
4-[[3-(trifluoromethyl)phenyl]iminomethyl]-1,2-dihydropyrazol-3-one (PubChem CID 3705508) has the molecular formula C11H8F3N3O and a molecular weight of 255.20 g/mol. Its IUPAC name is 4-[[3-(trifluoromethyl)phenyl]iminomethyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[[3-(trifluoromethyl)phenyl]iminomethyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 3705508 |
| Molecular Formula | C11H8F3N3O |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 4-[[3-(trifluoromethyl)phenyl]iminomethyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1[nH][nH]cc1/C=N/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F3N3O/c12-11(13,14)8-2-1-3-9(4-8)15-5-7-6-16-17-10(7)18/h1-6H,(H2,16,17,18)/b15-5+ |
| InChIKey | VLHJIXHJZVSZRU-PJQLUOCWSA-N |
| XLogP | 2.47 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|