C13H12F3N3O — CID 4295180
4-[(2,6-dimethylphenyl)iminomethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one (PubChem CID 4295180) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 4-[(2,6-dimethylphenyl)iminomethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[(2,6-dimethylphenyl)iminomethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 4295180 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-[(2,6-dimethylphenyl)iminomethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one |
| SMILES | Cc1cccc(C)c1/N=C/c1c(C(F)(F)F)[nH][nH]c1=O |
| InChI | InChI=1S/C13H12F3N3O/c1-7-4-3-5-8(2)10(7)17-6-9-11(13(14,15)16)18-19-12(9)20/h3-6H,1-2H3,(H2,18,19,20)/b17-6+ |
| InChIKey | AWWQGBFACOSXOR-UBKPWBPPSA-N |
| XLogP | 3.09 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|