C13H9F6N3O — CID 4315271
5-(trifluoromethyl)-4-[[3-(trifluoromethyl)phenyl]methyliminomethyl]-1,2-dihydropyrazol-3-one (PubChem CID 4315271) has the molecular formula C13H9F6N3O and a molecular weight of 337.22 g/mol. Its IUPAC name is 5-(trifluoromethyl)-4-[[3-(trifluoromethyl)phenyl]methyliminomethyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-(trifluoromethyl)-4-[[3-(trifluoromethyl)phenyl]methyliminomethyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 4315271 |
| Molecular Formula | C13H9F6N3O |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 5-(trifluoromethyl)-4-[[3-(trifluoromethyl)phenyl]methyliminomethyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1[nH][nH]c(C(F)(F)F)c1/C=N/Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9F6N3O/c14-12(15,16)8-3-1-2-7(4-8)5-20-6-9-10(13(17,18)19)21-22-11(9)23/h1-4,6H,5H2,(H2,21,22,23)/b20-6+ |
| InChIKey | CRHLEJDSXIJYAE-CGOBSMCZSA-N |
| XLogP | 3.36 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|