C20H26N6OS — CID 37104729
N'-[5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]-N-pyridin-2-ylethane-1,2-diamine (PubChem CID 37104729) has the molecular formula C20H26N6OS and a molecular weight of 398.54 g/mol. Its IUPAC name is N'-[5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]-N-pyridin-2-ylethane-1,2-diamine.
| Compound Name | N'-[5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]-N-pyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 37104729 |
| Molecular Formula | C20H26N6OS |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N'-[5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]-N-pyridin-2-ylethane-1,2-diamine |
| SMILES | Cc1sc2nc(CN3CCOCC3)nc(NCCNc3ccccn3)c2c1C |
| InChI | InChI=1S/C20H26N6OS/c1-14-15(2)28-20-18(14)19(23-8-7-22-16-5-3-4-6-21-16)24-17(25-20)13-26-9-11-27-12-10-26/h3-6H,7-13H2,1-2H3,(H,21,22)(H,23,24,25) |
| InChIKey | YQEDCTVOOXQXFG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|