C21H20ClN3O3 — CID 3710918
10a-[2-(2-chloro-5-nitrophenyl)ethenyl]-10,10-dimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one (PubChem CID 3710918) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is 10a-[2-(2-chloro-5-nitrophenyl)ethenyl]-10,10-dimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one.
| Compound Name | 10a-[2-(2-chloro-5-nitrophenyl)ethenyl]-10,10-dimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 3710918 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 10a-[2-(2-chloro-5-nitrophenyl)ethenyl]-10,10-dimethyl-3,4-dihydro-1H-pyrimido[1,2-a]indol-2-one |
| SMILES | CC1(C)c2ccccc2N2CCC(=O)NC21C=Cc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H20ClN3O3/c1-20(2)16-5-3-4-6-18(16)24-12-10-19(26)23-21(20,24)11-9-14-13-15(25(27)28)7-8-17(14)22/h3-9,11,13H,10,12H2,1-2H3,(H,23,26) |
| InChIKey | GQXAZZXTBTXCGY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|