C25H20ClN5O2 — CID 3711123
3-(4-chlorophenyl)-N-(5-cyano-11-methyl-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)prop-2-enamide (PubChem CID 3711123) has the molecular formula C25H20ClN5O2 and a molecular weight of 457.92 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(5-cyano-11-methyl-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-(5-cyano-11-methyl-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)prop-2-enamide |
|---|---|
| PubChem CID | 3711123 |
| Molecular Formula | C25H20ClN5O2 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(5-cyano-11-methyl-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)prop-2-enamide |
| SMILES | CCCn1/c(=N/C(=O)C=Cc2ccc(Cl)cc2)c(C#N)cc2c(=O)n3cccc(C)c3nc21 |
| InChI | InChI=1S/C25H20ClN5O2/c1-3-12-30-23(28-21(32)11-8-17-6-9-19(26)10-7-17)18(15-27)14-20-24(30)29-22-16(2)5-4-13-31(22)25(20)33/h4-11,13-14H,3,12H2,1-2H3/b11-8?,28-23+ |
| InChIKey | VVMMNKPEIOXQAQ-JKCZXXHDSA-N |
| XLogP | 4.03 |
| TPSA | 92.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|