C28H19N5O2 — CID 2312679
(E)-N-(7-benzyl-5-cyano-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)-3-phenylprop-2-enamide (PubChem CID 2312679) has the molecular formula C28H19N5O2 and a molecular weight of 457.49 g/mol. Its IUPAC name is (E)-N-(7-benzyl-5-cyano-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(7-benzyl-5-cyano-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 2312679 |
| Molecular Formula | C28H19N5O2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (E)-N-(7-benzyl-5-cyano-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)-3-phenylprop-2-enamide |
| SMILES | N#Cc1cc2c(=O)n3ccccc3nc2n(Cc2ccccc2)/c1=N/C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C28H19N5O2/c29-18-22-17-23-27(30-24-13-7-8-16-32(24)28(23)35)33(19-21-11-5-2-6-12-21)26(22)31-25(34)15-14-20-9-3-1-4-10-20/h1-17H,19H2/b15-14+,31-26+ |
| InChIKey | NXJZHMUQLLFNMN-YFVRRPPYSA-N |
| XLogP | 3.71 |
| TPSA | 92.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|