C17H20Br2N2O3 — CID 3715613
ethyl 5-bromo-3-(2-bromohexanoylamino)-1H-indole-2-carboxylate (PubChem CID 3715613) has the molecular formula C17H20Br2N2O3 and a molecular weight of 460.17 g/mol. Its IUPAC name is ethyl 5-bromo-3-(2-bromohexanoylamino)-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-bromo-3-(2-bromohexanoylamino)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 3715613 |
| Molecular Formula | C17H20Br2N2O3 |
| Molecular Weight | 460.17 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | ethyl 5-bromo-3-(2-bromohexanoylamino)-1H-indole-2-carboxylate |
| SMILES | CCCCC(Br)C(=O)Nc1c(C(=O)OCC)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C17H20Br2N2O3/c1-3-5-6-12(19)16(22)21-14-11-9-10(18)7-8-13(11)20-15(14)17(23)24-4-2/h7-9,12,20H,3-6H2,1-2H3,(H,21,22) |
| InChIKey | QQUTWBKAWUMXEI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.17 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|