About 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole
5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole (PubChem CID 3718560) has the molecular formula C17H9BrN2O3
and a molecular weight of 369.17 g/mol. Its IUPAC name is 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole.
Molecular Properties
| Compound Name | 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole |
| PubChem CID | 3718560 |
| Molecular Formula | C17H9BrN2O3 |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3c(cc(Br)c4ccccc43)o2)cc1 |
| InChI | InChI=1S/C17H9BrN2O3/c18-14-9-15-16(13-4-2-1-3-12(13)14)19-17(23-15)10-5-7-11(8-6-10)20(21)22/h1-9H |
| InChIKey | ONQOFBZASCCHDI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole?
The IUPAC name of 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole (CID 3718560) is 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole.
What is the SMILES notation for 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole?
The canonical SMILES for 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole is O=[N+]([O-])c1ccc(-c2nc3c(cc(Br)c4ccccc43)o2)cc1.
What is the InChIKey of 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole?
The InChIKey is ONQOFBZASCCHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9BrN2O3/c18-14-9-15-16(13-4-2-1-3-12(13)14)19-17(23-15)10-5-7-11(8-6-10)20(21)22/h1-9H.
What are the key properties of 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole?
5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole has a molecular weight of 369.17 g/mol, XLogP of 5.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(4-nitrophenyl)benzo[e][1,3]benzoxazole is sourced from PubChem (CID 3718560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).