C26H21Cl2N3O2S — CID 3719085
11-benzyl-5-[5-(3,4-dichlorophenyl)furan-2-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one (PubChem CID 3719085) has the molecular formula C26H21Cl2N3O2S and a molecular weight of 510.45 g/mol. Its IUPAC name is 11-benzyl-5-[5-(3,4-dichlorophenyl)furan-2-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one.
| Compound Name | 11-benzyl-5-[5-(3,4-dichlorophenyl)furan-2-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
|---|---|
| PubChem CID | 3719085 |
| Molecular Formula | C26H21Cl2N3O2S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | 11-benzyl-5-[5-(3,4-dichlorophenyl)furan-2-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-3-one |
| SMILES | O=C1NC(c2ccc(-c3ccc(Cl)c(Cl)c3)o2)Nc2sc3c(c21)CCN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C26H21Cl2N3O2S/c27-18-7-6-16(12-19(18)28)20-8-9-21(33-20)24-29-25(32)23-17-10-11-31(13-15-4-2-1-3-5-15)14-22(17)34-26(23)30-24/h1-9,12,24,30H,10-11,13-14H2,(H,29,32) |
| InChIKey | HZWKHWFQTWWTFH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |