C21H21BrCl2N4O3 — CID 3720505
N'-(4-bromophenyl)-N-[2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]ethyl]oxamide (PubChem CID 3720505) has the molecular formula C21H21BrCl2N4O3 and a molecular weight of 528.23 g/mol. Its IUPAC name is N'-(4-bromophenyl)-N-[2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]ethyl]oxamide.
| Compound Name | N'-(4-bromophenyl)-N-[2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 3720505 |
| Molecular Formula | C21H21BrCl2N4O3 |
| Molecular Weight | 528.23 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | N'-(4-bromophenyl)-N-[2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]ethyl]oxamide |
| SMILES | O=C(NCCN1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H21BrCl2N4O3/c22-14-1-4-16(5-2-14)26-20(30)19(29)25-7-8-27-9-11-28(12-10-27)21(31)17-6-3-15(23)13-18(17)24/h1-6,13H,7-12H2,(H,25,29)(H,26,30) |
| InChIKey | RMRSEVRQGJQOQH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|