About [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone
[4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 3721009) has the molecular formula C25H23ClFNO
and a molecular weight of 407.92 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone |
| PubChem CID | 3721009 |
| Molecular Formula | C25H23ClFNO |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | CC1(c2ccc(Cl)cc2)CC(C)(C)N(C(=O)c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H23ClFNO/c1-24(2)16-25(3,18-10-12-19(26)13-11-18)21-6-4-5-7-22(21)28(24)23(29)17-8-14-20(27)15-9-17/h4-15H,16H2,1-3H3 |
| InChIKey | LJVLRZWQCUSANA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone?
The IUPAC name of [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone (CID 3721009) is [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone.
What is the SMILES notation for [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone?
The canonical SMILES for [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone is CC1(c2ccc(Cl)cc2)CC(C)(C)N(C(=O)c2ccc(F)cc2)c2ccccc21.
What is the InChIKey of [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone?
The InChIKey is LJVLRZWQCUSANA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23ClFNO/c1-24(2)16-25(3,18-10-12-19(26)13-11-18)21-6-4-5-7-22(21)28(24)23(29)17-8-14-20(27)15-9-17/h4-15H,16H2,1-3H3.
What are the key properties of [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone?
[4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone has a molecular weight of 407.92 g/mol, XLogP of 6.61, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-(4-fluorophenyl)methanone is sourced from PubChem (CID 3721009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).